This is an unofficial archive of PsychonautWiki as of 2025-08-08T03:33:20Z. Content on this page may be outdated, incomplete, or inaccurate. Please refer to the original page for the most up-to-date information.
MDxx: Difference between revisions
Jump to navigation
Jump to search
>Pharmreduction m changed name to ephylone |
>Tracer Grammatics |
||
| (7 intermediate revisions by 2 users not shown) | |||
| Line 53: | Line 53: | ||
|- | |- | ||
| [[Apiole]] || OCH<sub>3</sub> || CH<sub>2</sub>CHCH<sub>2</sub> || H || OCH<sub>3</sub> || [[File:Apiole.svg|171px]] | | [[Apiole]] || OCH<sub>3</sub> || CH<sub>2</sub>CHCH<sub>2</sub> || H || OCH<sub>3</sub> || [[File:Apiole.svg|171px]] | ||
|- | |||
| [[Dihydromethysticin]] || H || CH<sub>2</sub>CH<sub>2</sub>C<sub>6</sub>H<sub>7</sub>O<sub>3</sub> || H || H || [[File:Dihydromethysticin.svg|171px]] | |||
|- | |||
| [[Methysticin]] || H || CHCHC<sub>6</sub>H<sub>7</sub>O<sub>3</sub> || H || H || [[File:Methysticin.svg|171px]] | |||
|- | |||
| [[Paroxetine]] || H || OCH<sub>2</sub>CH(CH<sub>2</sub>NH-)CH(CH<sub>2</sub>CH<sub>2</sub>-)C<sub>6</sub>H<sub>4</sub>F || H || H || [[File:Paroxetine.svg|171px]] | |||
|- | |- | ||
|} | |} | ||
Latest revision as of 00:50, 4 October 2021
 |
This article is a stub. As such, it may contain incomplete or wrong information. You can help by expanding it. |
Substituted methylenedioxybenzenes (also known as MDxx) are a chemical class of compounds which contain a 1,2-methylenedioxybenzene ring system in their structure.
Chemistry
 |
This chemistry section is incomplete. You can help by adding to it. |
List of MDxx compounds
| Compound | R3 | R4 | R5 | R6 | Structure |
|---|---|---|---|---|---|
| 1,3-Benzodioxole | H | H | H | H | 
|
| MDPEA | H | CH2CH2NH2 | H | H | 
|
| MDA | H | CH2CH(NH2)CH3 | H | H | 
|
| MDMA | H | CH2CH(NHCH3)CH3 | H | H | 
|
| MDEA | H | CH2CH(NHCH2CH3)CH3 | H | H | 
|
| MBDB | H | CH2CH(NHCH3)CH2CH3 | H | H | 
|
| Methylone | H | COCH(NHCH3)CH3 | H | H | 
|
| Ethylone | H | COCH(NHCH2CH3)CH3 | H | H | 
|
| Butylone | H | COCH(NHCH3)CH2CH3 | H | H | 
|
| Pentylone | H | COCH(NHCH3)CH2CH2CH3 | H | H | 
|
| Ephylone | H | COCH(NHCH2CH3)CH2CH2CH3 | H | H | 
|
| MDPV | H | COCH(NC4H8)CH2CH2CH3 | H | H | 
|
| MDPHP | H | COCH(NC4H8)CH2CH2CH2CH3 | H | H | 
|
| MDAI | H | CH2C(NH2)- | CH2- | H | 
|
| Lophophine | H | CH2CH2NH2 | H | OCH3 | 
|
| MMDA | H | CH2CH(NH2)CH3 | H | OCH3 | 
|
| Safrole | H | CH2CHCH2 | H | H | 
|
| Myristicin | H | CH2CHCH2 | H | OCH3 | 
|
| Apiole | OCH3 | CH2CHCH2 | H | OCH3 | 
|
| Dihydromethysticin | H | CH2CH2C6H7O3 | H | H | 
|
| Methysticin | H | CHCHC6H7O3 | H | H | 
|
| Paroxetine | H | OCH2CH(CH2NH-)CH(CH2CH2-)C6H4F | H | H | 
|
See also
External links
References
 |
This article does not cite enough references. You can help by adding some. |